C28H35N5O2 — CID 129072695
2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile (PubChem CID 129072695) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile.
| Compound Name | 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 129072695 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile |
| SMILES | Cc1ccc(-c2cc(NC3CCN(C)CC3)c3cc(C#N)c(OCCCN4CCCC4)cc3n2)o1 |
| InChI | InChI=1S/C28H35N5O2/c1-20-6-7-27(35-20)26-17-24(30-22-8-13-32(2)14-9-22)23-16-21(19-29)28(18-25(23)31-26)34-15-5-12-33-10-3-4-11-33/h6-7,16-18,22H,3-5,8-15H2,1-2H3,(H,30,31) |
| InChIKey | CTLBSSWLVZIRCU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|