C27H36N4O3 — CID 118607465
2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinolin-6-ol (PubChem CID 118607465) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinolin-6-ol.
| Compound Name | 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinolin-6-ol |
|---|---|
| PubChem CID | 118607465 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-4-[(1-methylpiperidin-4-yl)amino]-7-(3-pyrrolidin-1-ylpropoxy)quinolin-6-ol |
| SMILES | Cc1ccc(-c2cc(NC3CCN(C)CC3)c3cc(O)c(OCCCN4CCCC4)cc3n2)o1 |
| InChI | InChI=1S/C27H36N4O3/c1-19-6-7-26(34-19)24-17-22(28-20-8-13-30(2)14-9-20)21-16-25(32)27(18-23(21)29-24)33-15-5-12-31-10-3-4-11-31/h6-7,16-18,20,32H,3-5,8-15H2,1-2H3,(H,28,29) |
| InChIKey | ZDTIJWKWNYJIAB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|