C36H44N4O4 — CID 153375939
4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide (PubChem CID 153375939) has the molecular formula C36H44N4O4 and a molecular weight of 596.77 g/mol. Its IUPAC name is 4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide.
| Compound Name | 4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 153375939 |
| Molecular Formula | C36H44N4O4 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide |
| SMILES | COc1cc2c(NCC3CCC(c4ccc(C(N)=O)cc4)CC3)cc(-c3ccc(C)o3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C36H44N4O4/c1-24-6-15-33(44-24)32-21-30(38-23-25-7-9-26(10-8-25)27-11-13-28(14-12-27)36(37)41)29-20-34(42-2)35(22-31(29)39-32)43-19-5-18-40-16-3-4-17-40/h6,11-15,20-22,25-26H,3-5,7-10,16-19,23H2,1-2H3,(H2,37,41)(H,38,39) |
| InChIKey | HWWMXTWYGQLISW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|