C25H30F3N3O3 — CID 118613725
6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)-N-(3,3,3-trifluoropropyl)quinolin-4-amine (PubChem CID 118613725) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is 6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)-N-(3,3,3-trifluoropropyl)quinolin-4-amine.
| Compound Name | 6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)-N-(3,3,3-trifluoropropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 118613725 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)-N-(3,3,3-trifluoropropyl)quinolin-4-amine |
| SMILES | COc1cc2c(NCCC(F)(F)F)cc(-c3ccc(C)o3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H30F3N3O3/c1-17-6-7-22(34-17)21-15-19(29-9-8-25(26,27)28)18-14-23(32-2)24(16-20(18)30-21)33-13-5-12-31-10-3-4-11-31/h6-7,14-16H,3-5,8-13H2,1-2H3,(H,29,30) |
| InChIKey | WGLDJRWXKBGEHT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|