C36H44N4O5 — CID 142495336
N-hydroxy-4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide (PubChem CID 142495336) has the molecular formula C36H44N4O5 and a molecular weight of 612.77 g/mol. Its IUPAC name is N-hydroxy-4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide.
| Compound Name | N-hydroxy-4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 142495336 |
| Molecular Formula | C36H44N4O5 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | N-hydroxy-4-[4-[[[6-methoxy-2-(5-methylfuran-2-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]amino]methyl]cyclohexyl]benzamide |
| SMILES | COc1cc2c(NCC3CCC(c4ccc(C(=O)NO)cc4)CC3)cc(-c3ccc(C)o3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C36H44N4O5/c1-24-6-15-33(45-24)32-21-30(37-23-25-7-9-26(10-8-25)27-11-13-28(14-12-27)36(41)39-42)29-20-34(43-2)35(22-31(29)38-32)44-19-5-18-40-16-3-4-17-40/h6,11-15,20-22,25-26,42H,3-5,7-10,16-19,23H2,1-2H3,(H,37,38)(H,39,41) |
| InChIKey | FSACPLDXILRSSO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|