C23H34N4O — CID 166633012
2-methyl-N-(1-methylpiperidin-4-yl)-6-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine (PubChem CID 166633012) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-methyl-N-(1-methylpiperidin-4-yl)-6-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine.
| Compound Name | 2-methyl-N-(1-methylpiperidin-4-yl)-6-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
|---|---|
| PubChem CID | 166633012 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-methyl-N-(1-methylpiperidin-4-yl)-6-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
| SMILES | Cc1cc(NC2CCN(C)CC2)c2cc(OCCCN3CCCC3)ccc2n1 |
| InChI | InChI=1S/C23H34N4O/c1-18-16-23(25-19-8-13-26(2)14-9-19)21-17-20(6-7-22(21)24-18)28-15-5-12-27-10-3-4-11-27/h6-7,16-17,19H,3-5,8-15H2,1-2H3,(H,24,25) |
| InChIKey | DIQFEQUOPUGKGA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|