C18H29N3 — CID 129074127
2,7-bis(3-methylpentan-3-yl)imidazo[1,2-a]pyrimidine (PubChem CID 129074127) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2,7-bis(3-methylpentan-3-yl)imidazo[1,2-a]pyrimidine.
| Compound Name | 2,7-bis(3-methylpentan-3-yl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 129074127 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2,7-bis(3-methylpentan-3-yl)imidazo[1,2-a]pyrimidine |
| SMILES | CCC(C)(CC)c1ccn2cc(C(C)(CC)CC)nc2n1 |
| InChI | InChI=1S/C18H29N3/c1-7-17(5,8-2)14-11-12-21-13-15(20-16(21)19-14)18(6,9-3)10-4/h11-13H,7-10H2,1-6H3 |
| InChIKey | GROIQSLCEHTNIC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |