C18H22N8 — CID 126724656
6-tert-butyl-2-(2-imidazo[1,2-a][1,3,5]triazin-7-yl-2-methylpropyl)imidazo[1,2-b][1,2,4]triazine (PubChem CID 126724656) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is 6-tert-butyl-2-(2-imidazo[1,2-a][1,3,5]triazin-7-yl-2-methylpropyl)imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 6-tert-butyl-2-(2-imidazo[1,2-a][1,3,5]triazin-7-yl-2-methylpropyl)imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 126724656 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 6-tert-butyl-2-(2-imidazo[1,2-a][1,3,5]triazin-7-yl-2-methylpropyl)imidazo[1,2-b][1,2,4]triazine |
| SMILES | CC(C)(C)c1cn2nc(CC(C)(C)c3cn4cncnc4n3)cnc2n1 |
| InChI | InChI=1S/C18H22N8/c1-17(2,3)13-9-26-16(22-13)20-7-12(24-26)6-18(4,5)14-8-25-11-19-10-21-15(25)23-14/h7-11H,6H2,1-5H3 |
| InChIKey | KAJMWVPCWFUQJE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |