C7H10N6O — CID 139606318
N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-amine (PubChem CID 139606318) has the molecular formula C7H10N6O and a molecular weight of 194.20 g/mol. Its IUPAC name is N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-amine.
| Compound Name | N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-amine |
|---|---|
| PubChem CID | 139606318 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-(2-methoxyethyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-amine |
| SMILES | COCCNc1nc2ncncn2n1 |
| InChI | InChI=1S/C7H10N6O/c1-14-3-2-9-6-11-7-10-4-8-5-13(7)12-6/h4-5H,2-3H2,1H3,(H,9,12) |
| InChIKey | ABIDEBHDHTWICS-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|