C7H9I2N3O — CID 87732677
4,6-diiodo-N-(2-methoxyethyl)pyrimidin-2-amine (PubChem CID 87732677) has the molecular formula C7H9I2N3O and a molecular weight of 404.98 g/mol. Its IUPAC name is 4,6-diiodo-N-(2-methoxyethyl)pyrimidin-2-amine.
| Compound Name | 4,6-diiodo-N-(2-methoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 87732677 |
| Molecular Formula | C7H9I2N3O |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.88 |
| IUPAC Name | 4,6-diiodo-N-(2-methoxyethyl)pyrimidin-2-amine |
| SMILES | COCCNc1nc(I)cc(I)n1 |
| InChI | InChI=1S/C7H9I2N3O/c1-13-3-2-10-7-11-5(8)4-6(9)12-7/h4H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | DZTLULOQDSSPJF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|