C12H17N3 — CID 82059965
2-tert-butyl-7-methylimidazo[1,2-a]pyridin-8-amine (PubChem CID 82059965) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-tert-butyl-7-methylimidazo[1,2-a]pyridin-8-amine.
| Compound Name | 2-tert-butyl-7-methylimidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 82059965 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-tert-butyl-7-methylimidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1ccn2cc(C(C)(C)C)nc2c1N |
| InChI | InChI=1S/C12H17N3/c1-8-5-6-15-7-9(12(2,3)4)14-11(15)10(8)13/h5-7H,13H2,1-4H3 |
| InChIKey | QIZCLXKQMVUZHK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |