C19H20N2O2 — CID 93211518
4-(2-tert-butyl-8-methylimidazo[1,2-a]pyridin-6-yl)benzoic acid (PubChem CID 93211518) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(2-tert-butyl-8-methylimidazo[1,2-a]pyridin-6-yl)benzoic acid.
| Compound Name | 4-(2-tert-butyl-8-methylimidazo[1,2-a]pyridin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 93211518 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-(2-tert-butyl-8-methylimidazo[1,2-a]pyridin-6-yl)benzoic acid |
| SMILES | Cc1cc(-c2ccc(C(=O)O)cc2)cn2cc(C(C)(C)C)nc12 |
| InChI | InChI=1S/C19H20N2O2/c1-12-9-15(13-5-7-14(8-6-13)18(22)23)10-21-11-16(19(2,3)4)20-17(12)21/h5-11H,1-4H3,(H,22,23) |
| InChIKey | FFUZDROILKRHNR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |