4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid

C13H10N2O2S — CID 164581256

IUPAC4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid
SMILESCc1cn2cc(-c3ccc(C(=O)O)cc3)nc2s1
InChIInChI=1S/C13H10N2O2S/c1-8-6-15-7-11(14-13(15)18-8)9-2-4-10(5-3-9)12(16)17/h2-7H,1H3,(H,16,17)
InChIKeyZRNQWFAVJGULDX-UHFFFAOYSA-N
MW258.30 g/mol
LogP3.07
Rot. Bonds2

About 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid

4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid (PubChem CID 164581256) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid.

Molecular Properties

Compound Name4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid
PubChem CID164581256
Molecular FormulaC13H10N2O2S
Molecular Weight258.30 g/mol
Exact Mass258.05
IUPAC Name4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid
SMILESCc1cn2cc(-c3ccc(C(=O)O)cc3)nc2s1
InChIInChI=1S/C13H10N2O2S/c1-8-6-15-7-11(14-13(15)18-8)9-2-4-10(5-3-9)12(16)17/h2-7H,1H3,(H,16,17)
InChIKeyZRNQWFAVJGULDX-UHFFFAOYSA-N
XLogP3.07
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.30
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid?
The IUPAC name of 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid (CID 164581256) is 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid.
What is the SMILES notation for 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid?
The canonical SMILES for 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid is Cc1cn2cc(-c3ccc(C(=O)O)cc3)nc2s1.
What is the InChIKey of 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid?
The InChIKey is ZRNQWFAVJGULDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2S/c1-8-6-15-7-11(14-13(15)18-8)9-2-4-10(5-3-9)12(16)17/h2-7H,1H3,(H,16,17).
What are the key properties of 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid?
4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid has a molecular weight of 258.30 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)benzoic acid is sourced from PubChem (CID 164581256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).