C22H21ClN4O2 — CID 129075889
(3R)-N-(6-chloro-7-cyano-1-cyclobutylbenzimidazol-2-yl)-3-hydroxy-3-phenylbutanamide (PubChem CID 129075889) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is (3R)-N-(6-chloro-7-cyano-1-cyclobutylbenzimidazol-2-yl)-3-hydroxy-3-phenylbutanamide.
| Compound Name | (3R)-N-(6-chloro-7-cyano-1-cyclobutylbenzimidazol-2-yl)-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 129075889 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (3R)-N-(6-chloro-7-cyano-1-cyclobutylbenzimidazol-2-yl)-3-hydroxy-3-phenylbutanamide |
| SMILES | C[C@@](O)(CC(=O)Nc1nc2ccc(Cl)c(C#N)c2n1C1CCC1)c1ccccc1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-22(29,14-6-3-2-4-7-14)12-19(28)26-21-25-18-11-10-17(23)16(13-24)20(18)27(21)15-8-5-9-15/h2-4,6-7,10-11,15,29H,5,8-9,12H2,1H3,(H,25,26,28)/t22-/m1/s1 |
| InChIKey | BKCJNXQNOKCBHI-JOCHJYFZSA-N |
| XLogP | 4.52 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |