C30H35F2N7O2 — CID 129077406
N-[amino-[3-amino-6-[(3,5-difluorophenyl)methyl]pyrazin-2-yl]methylidene]-4-(1-methylpiperidin-4-yl)-2-(oxan-4-ylamino)benzamide (PubChem CID 129077406) has the molecular formula C30H35F2N7O2 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-[amino-[3-amino-6-[(3,5-difluorophenyl)methyl]pyrazin-2-yl]methylidene]-4-(1-methylpiperidin-4-yl)-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-[amino-[3-amino-6-[(3,5-difluorophenyl)methyl]pyrazin-2-yl]methylidene]-4-(1-methylpiperidin-4-yl)-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 129077406 |
| Molecular Formula | C30H35F2N7O2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[amino-[3-amino-6-[(3,5-difluorophenyl)methyl]pyrazin-2-yl]methylidene]-4-(1-methylpiperidin-4-yl)-2-(oxan-4-ylamino)benzamide |
| SMILES | CN1CCC(c2ccc(C(=O)/N=C(\N)c3nc(Cc4cc(F)cc(F)c4)cnc3N)c(NC3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C30H35F2N7O2/c1-39-8-4-19(5-9-39)20-2-3-25(26(15-20)36-23-6-10-41-11-7-23)30(40)38-29(34)27-28(33)35-17-24(37-27)14-18-12-21(31)16-22(32)13-18/h2-3,12-13,15-17,19,23,36H,4-11,14H2,1H3,(H2,33,35)(H2,34,38,40) |
| InChIKey | BQDKISHXYLVBHV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|