C37H42F2N8O2 — CID 145101658
N-[amino-[2-amino-4-(6-amino-4-methyl-3-pyridinyl)-5-[(3,5-difluorophenyl)methyl]phenyl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide (PubChem CID 145101658) has the molecular formula C37H42F2N8O2 and a molecular weight of 668.79 g/mol. Its IUPAC name is N-[amino-[2-amino-4-(6-amino-4-methyl-3-pyridinyl)-5-[(3,5-difluorophenyl)methyl]phenyl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-[amino-[2-amino-4-(6-amino-4-methyl-3-pyridinyl)-5-[(3,5-difluorophenyl)methyl]phenyl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 145101658 |
| Molecular Formula | C37H42F2N8O2 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | N-[amino-[2-amino-4-(6-amino-4-methyl-3-pyridinyl)-5-[(3,5-difluorophenyl)methyl]phenyl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
| SMILES | Cc1cc(N)ncc1-c1cc(N)c(/C(N)=N/C(=O)c2ccc(N3CCN(C)CC3)cc2NC2CCOCC2)cc1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C37H42F2N8O2/c1-22-13-35(41)43-21-32(22)30-20-33(40)31(17-24(30)14-23-15-25(38)18-26(39)16-23)36(42)45-37(48)29-4-3-28(47-9-7-46(2)8-10-47)19-34(29)44-27-5-11-49-12-6-27/h3-4,13,15-21,27,44H,5-12,14,40H2,1-2H3,(H2,41,43)(H2,42,45,48) |
| InChIKey | ALBCHKLTCBQUSO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 148.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|