C29H35F2N8O3P — CID 129077023
N-[amino-[3-amino-6-[(3,5-difluorophenyl)-methylphosphanyl]oxypyrazin-2-yl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide (PubChem CID 129077023) has the molecular formula C29H35F2N8O3P and a molecular weight of 612.62 g/mol. Its IUPAC name is N-[amino-[3-amino-6-[(3,5-difluorophenyl)-methylphosphanyl]oxypyrazin-2-yl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-[amino-[3-amino-6-[(3,5-difluorophenyl)-methylphosphanyl]oxypyrazin-2-yl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 129077023 |
| Molecular Formula | C29H35F2N8O3P |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | N-[amino-[3-amino-6-[(3,5-difluorophenyl)-methylphosphanyl]oxypyrazin-2-yl]methylidene]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)/N=C(\N)c3nc(OP(C)c4cc(F)cc(F)c4)cnc3N)c(NC3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C29H35F2N8O3P/c1-38-7-9-39(10-8-38)21-3-4-23(24(16-21)35-20-5-11-41-12-6-20)29(40)37-28(33)26-27(32)34-17-25(36-26)42-43(2)22-14-18(30)13-19(31)15-22/h3-4,13-17,20,35H,5-12H2,1-2H3,(H2,32,34)(H2,33,37,40) |
| InChIKey | BSJZIJPHNBPTIN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|