C16H19N5O2 — CID 129078754
ethyl 1-[[5-(3-azabicyclo[3.1.0]hexan-3-yl)pyrazin-2-yl]methyl]pyrazole-4-carboxylate (PubChem CID 129078754) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 1-[[5-(3-azabicyclo[3.1.0]hexan-3-yl)pyrazin-2-yl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[[5-(3-azabicyclo[3.1.0]hexan-3-yl)pyrazin-2-yl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 129078754 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 1-[[5-(3-azabicyclo[3.1.0]hexan-3-yl)pyrazin-2-yl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2cnc(N3CC4CC4C3)cn2)c1 |
| InChI | InChI=1S/C16H19N5O2/c1-2-23-16(22)13-4-19-21(9-13)10-14-5-18-15(6-17-14)20-7-11-3-12(11)8-20/h4-6,9,11-12H,2-3,7-8,10H2,1H3 |
| InChIKey | MGUQYTRCATWVTR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |