C18H20N4O3 — CID 156825859
ethyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-formyl-3-pyridinyl]methyl]pyrazole-4-carboxylate (PubChem CID 156825859) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-formyl-3-pyridinyl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-formyl-3-pyridinyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 156825859 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-formyl-3-pyridinyl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2ccc(N3CC4CC4C3)nc2C=O)c1 |
| InChI | InChI=1S/C18H20N4O3/c1-2-25-18(24)15-6-19-22(10-15)9-12-3-4-17(20-16(12)11-23)21-7-13-5-14(13)8-21/h3-4,6,10-11,13-14H,2,5,7-9H2,1H3 |
| InChIKey | XRUTVCOOALKMJH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|