C16H17ClN4O2 — CID 165179349
methyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-chloro-3-pyridinyl]methyl]pyrazole-4-carboxylate (PubChem CID 165179349) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is methyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-chloro-3-pyridinyl]methyl]pyrazole-4-carboxylate.
| Compound Name | methyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-chloro-3-pyridinyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 165179349 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl 1-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-chloro-3-pyridinyl]methyl]pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(Cc2ccc(N3CC4CC4C3)nc2Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-23-16(22)13-5-18-21(9-13)8-10-2-3-14(19-15(10)17)20-6-11-4-12(11)7-20/h2-3,5,9,11-12H,4,6-8H2,1H3 |
| InChIKey | BRGDFMNXIJBOTR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|