C23H20BrClN4O4 — CID 129080808
[3-(5-bromopentanoylamino)-4-[4-(5-chloropyridine-2-carbonyl)-2-pyridinyl]phenyl]carbamic acid (PubChem CID 129080808) has the molecular formula C23H20BrClN4O4 and a molecular weight of 531.79 g/mol. Its IUPAC name is [3-(5-bromopentanoylamino)-4-[4-(5-chloropyridine-2-carbonyl)-2-pyridinyl]phenyl]carbamic acid.
| Compound Name | [3-(5-bromopentanoylamino)-4-[4-(5-chloropyridine-2-carbonyl)-2-pyridinyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 129080808 |
| Molecular Formula | C23H20BrClN4O4 |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | [3-(5-bromopentanoylamino)-4-[4-(5-chloropyridine-2-carbonyl)-2-pyridinyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(-c2cc(C(=O)c3ccc(Cl)cn3)ccn2)c(NC(=O)CCCCBr)c1 |
| InChI | InChI=1S/C23H20BrClN4O4/c24-9-2-1-3-21(30)29-20-12-16(28-23(32)33)5-6-17(20)19-11-14(8-10-26-19)22(31)18-7-4-15(25)13-27-18/h4-8,10-13,28H,1-3,9H2,(H,29,30)(H,32,33) |
| InChIKey | GRCSWXUHETZGFH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|