C13H25NO2S — CID 129081827
5-tert-butylsulfonyl-2,2,4,4-tetramethylpentanenitrile (PubChem CID 129081827) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 5-tert-butylsulfonyl-2,2,4,4-tetramethylpentanenitrile.
| Compound Name | 5-tert-butylsulfonyl-2,2,4,4-tetramethylpentanenitrile |
|---|---|
| PubChem CID | 129081827 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5-tert-butylsulfonyl-2,2,4,4-tetramethylpentanenitrile |
| SMILES | CC(C)(C#N)CC(C)(C)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2S/c1-11(2,3)17(15,16)10-13(6,7)8-12(4,5)9-14/h8,10H2,1-7H3 |
| InChIKey | XSCFCCJZFUPRDE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |