C15H33NO2S — CID 158712760
N-tert-butyl-5-tert-butylsulfonyl-4,4-dimethylpentan-1-amine (PubChem CID 158712760) has the molecular formula C15H33NO2S and a molecular weight of 291.50 g/mol. Its IUPAC name is N-tert-butyl-5-tert-butylsulfonyl-4,4-dimethylpentan-1-amine.
| Compound Name | N-tert-butyl-5-tert-butylsulfonyl-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 158712760 |
| Molecular Formula | C15H33NO2S |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-tert-butyl-5-tert-butylsulfonyl-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(CCCNC(C)(C)C)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H33NO2S/c1-13(2,3)16-11-9-10-15(7,8)12-19(17,18)14(4,5)6/h16H,9-12H2,1-8H3 |
| InChIKey | KSYOFFRQBVINEL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|