C14H16O14 — CID 129081970
2,4-bis(carboxymethyl)pentane-1,2,3,4,5-pentacarboxylic acid (PubChem CID 129081970) has the molecular formula C14H16O14 and a molecular weight of 408.27 g/mol. Its IUPAC name is 2,4-bis(carboxymethyl)pentane-1,2,3,4,5-pentacarboxylic acid.
| Compound Name | 2,4-bis(carboxymethyl)pentane-1,2,3,4,5-pentacarboxylic acid |
|---|---|
| PubChem CID | 129081970 |
| Molecular Formula | C14H16O14 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2,4-bis(carboxymethyl)pentane-1,2,3,4,5-pentacarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(C(=O)O)C(C(=O)O)C(CC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16O14/c15-5(16)1-13(11(25)26,2-6(17)18)9(10(23)24)14(12(27)28,3-7(19)20)4-8(21)22/h9H,1-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | UTVCEPZMYIMGLG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 261.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |