C14H12IN — CID 129082868
9-iodo-3,6-dimethylcarbazole (PubChem CID 129082868) has the molecular formula C14H12IN and a molecular weight of 321.16 g/mol. Its IUPAC name is 9-iodo-3,6-dimethylcarbazole.
| Compound Name | 9-iodo-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 129082868 |
| Molecular Formula | C14H12IN |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 9-iodo-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2I |
| InChI | InChI=1S/C14H12IN/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14(12)16(13)15/h3-8H,1-2H3 |
| InChIKey | VJXHZGWGYYFIQS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|