C18H13IN2 — CID 134214427
9-iodo-6-methyl-3-phenylpyrido[2,3-b]indole (PubChem CID 134214427) has the molecular formula C18H13IN2 and a molecular weight of 384.22 g/mol. Its IUPAC name is 9-iodo-6-methyl-3-phenylpyrido[2,3-b]indole.
| Compound Name | 9-iodo-6-methyl-3-phenylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 134214427 |
| Molecular Formula | C18H13IN2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 9-iodo-6-methyl-3-phenylpyrido[2,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1cc(-c3ccccc3)cnc1n2I |
| InChI | InChI=1S/C18H13IN2/c1-12-7-8-17-15(9-12)16-10-14(11-20-18(16)21(17)19)13-5-3-2-4-6-13/h2-11H,1H3 |
| InChIKey | LRAMXKPEZJJUQR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|