C20H15IN2 — CID 173167513
3-iodo-1-(4-methylphenyl)-5-phenylpyrrolo[2,3-b]pyridine (PubChem CID 173167513) has the molecular formula C20H15IN2 and a molecular weight of 410.26 g/mol. Its IUPAC name is 3-iodo-1-(4-methylphenyl)-5-phenylpyrrolo[2,3-b]pyridine.
| Compound Name | 3-iodo-1-(4-methylphenyl)-5-phenylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 173167513 |
| Molecular Formula | C20H15IN2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 3-iodo-1-(4-methylphenyl)-5-phenylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(-n2cc(I)c3cc(-c4ccccc4)cnc32)cc1 |
| InChI | InChI=1S/C20H15IN2/c1-14-7-9-17(10-8-14)23-13-19(21)18-11-16(12-22-20(18)23)15-5-3-2-4-6-15/h2-13H,1H3 |
| InChIKey | PTFRQCHPYDIXCC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|