C21H18IN3O2S — CID 59811949
4-(3-iodo-1-phenylperoxysulfanylpyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylaniline (PubChem CID 59811949) has the molecular formula C21H18IN3O2S and a molecular weight of 503.37 g/mol. Its IUPAC name is 4-(3-iodo-1-phenylperoxysulfanylpyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3-iodo-1-phenylperoxysulfanylpyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59811949 |
| Molecular Formula | C21H18IN3O2S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 4-(3-iodo-1-phenylperoxysulfanylpyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cnc3c(c2)c(I)cn3SOOc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18IN3O2S/c1-24(2)17-10-8-15(9-11-17)16-12-19-20(22)14-25(21(19)23-13-16)28-27-26-18-6-4-3-5-7-18/h3-14H,1-2H3 |
| InChIKey | ZDYVDERKRFEDCX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|