C30H24N4 — CID 23527812
9-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-3,6-dimethylcarbazole (PubChem CID 23527812) has the molecular formula C30H24N4 and a molecular weight of 440.55 g/mol. Its IUPAC name is 9-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 23527812 |
| Molecular Formula | C30H24N4 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 9-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2Cc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C30H24N4/c1-20-13-15-26-24(17-20)25-18-21(2)14-16-27(25)34(26)19-28-31-29(22-9-5-3-6-10-22)33-30(32-28)23-11-7-4-8-12-23/h3-18H,19H2,1-2H3 |
| InChIKey | UVACKEYYTXKSCP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |