C31H32ClN9O3 — CID 129083069
N-(5-chloro-2-pyridinyl)-4-[3-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-5-(N'-methylcarbamimidoyl)-4-(methylideneamino)-2-oxoimidazol-1-yl]benzamide (PubChem CID 129083069) has the molecular formula C31H32ClN9O3 and a molecular weight of 614.11 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4-[3-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-5-(N'-methylcarbamimidoyl)-4-(methylideneamino)-2-oxoimidazol-1-yl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4-[3-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-5-(N'-methylcarbamimidoyl)-4-(methylideneamino)-2-oxoimidazol-1-yl]benzamide |
|---|---|
| PubChem CID | 129083069 |
| Molecular Formula | C31H32ClN9O3 |
| Molecular Weight | 614.11 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4-[3-[3-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]phenyl]-5-(N'-methylcarbamimidoyl)-4-(methylideneamino)-2-oxoimidazol-1-yl]benzamide |
| SMILES | C=Nc1c(/C(N)=N/C)n(-c2ccc(C(=O)Nc3ccc(Cl)cn3)cc2)c(=O)n1-c1cccc(N(C)C(=O)/C=C/CN(C)C)c1 |
| InChI | InChI=1S/C31H32ClN9O3/c1-34-28(33)27-29(35-2)41(24-9-6-8-23(18-24)39(5)26(42)10-7-17-38(3)4)31(44)40(27)22-14-11-20(12-15-22)30(43)37-25-16-13-21(32)19-36-25/h6-16,18-19H,2,17H2,1,3-5H3,(H2,33,34)(H,36,37,43)/b10-7+ |
| InChIKey | RWWSCJZVUGZIPP-JXMROGBWSA-N |
| XLogP | 3.68 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|