C8H13N3O6 — CID 129083272
2-[(4-amino-5-oxopentanoyl)amino]-2-(carboxyamino)acetic acid (PubChem CID 129083272) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[(4-amino-5-oxopentanoyl)amino]-2-(carboxyamino)acetic acid.
| Compound Name | 2-[(4-amino-5-oxopentanoyl)amino]-2-(carboxyamino)acetic acid |
|---|---|
| PubChem CID | 129083272 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[(4-amino-5-oxopentanoyl)amino]-2-(carboxyamino)acetic acid |
| SMILES | NC(C=O)CCC(=O)NC(NC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13N3O6/c9-4(3-12)1-2-5(13)10-6(7(14)15)11-8(16)17/h3-4,6,11H,1-2,9H2,(H,10,13)(H,14,15)(H,16,17) |
| InChIKey | ZPIFIQQTVKFLPN-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|