C11H24N3O4P — CID 22875441
2-amino-4-methylphosphanylbutanal;(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid (PubChem CID 22875441) has the molecular formula C11H24N3O4P and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-amino-4-methylphosphanylbutanal;(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid.
| Compound Name | 2-amino-4-methylphosphanylbutanal;(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22875441 |
| Molecular Formula | C11H24N3O4P |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-amino-4-methylphosphanylbutanal;(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid |
| SMILES | CPCCC(N)C=O.C[C@H](N)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C6H12N2O3.C5H12NOP/c1-3(7)5(9)8-4(2)6(10)11;1-8-3-2-5(6)4-7/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);4-5,8H,2-3,6H2,1H3/t3-,4-;/m0./s1 |
| InChIKey | RRKPLXAVTAKSTC-MMALYQPHSA-N |
| XLogP | -0.87 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|