C15H24FNO — CID 129084795
(Z)-2-[(E)-1-fluoroprop-1-enyl]-3-methyl-1-[(2S)-2-methylpiperidin-1-yl]pent-2-en-1-one (PubChem CID 129084795) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is (Z)-2-[(E)-1-fluoroprop-1-enyl]-3-methyl-1-[(2S)-2-methylpiperidin-1-yl]pent-2-en-1-one.
| Compound Name | (Z)-2-[(E)-1-fluoroprop-1-enyl]-3-methyl-1-[(2S)-2-methylpiperidin-1-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 129084795 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (Z)-2-[(E)-1-fluoroprop-1-enyl]-3-methyl-1-[(2S)-2-methylpiperidin-1-yl]pent-2-en-1-one |
| SMILES | C/C=C(F)\C(C(=O)N1CCCC[C@@H]1C)=C(\C)CC |
| InChI | InChI=1S/C15H24FNO/c1-5-11(3)14(13(16)6-2)15(18)17-10-8-7-9-12(17)4/h6,12H,5,7-10H2,1-4H3/b13-6+,14-11+/t12-/m0/s1 |
| InChIKey | XRFMLNWJTJRIQA-QNGAJWIPSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|