C14H19F2NO — CID 166838489
(2E,3E)-3-fluoro-2-(1-fluoropropylidene)-1-piperidin-1-ylhexa-3,5-dien-1-one (PubChem CID 166838489) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is (2E,3E)-3-fluoro-2-(1-fluoropropylidene)-1-piperidin-1-ylhexa-3,5-dien-1-one.
| Compound Name | (2E,3E)-3-fluoro-2-(1-fluoropropylidene)-1-piperidin-1-ylhexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 166838489 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2E,3E)-3-fluoro-2-(1-fluoropropylidene)-1-piperidin-1-ylhexa-3,5-dien-1-one |
| SMILES | C=C/C=C(F)\C(C(=O)N1CCCCC1)=C(\F)CC |
| InChI | InChI=1S/C14H19F2NO/c1-3-8-12(16)13(11(15)4-2)14(18)17-9-6-5-7-10-17/h3,8H,1,4-7,9-10H2,2H3/b12-8+,13-11- |
| InChIKey | MQHPXUIMVBUWPQ-JERBJKNKSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|