C14H21ClO3 — CID 129084836
3-[1-(2-chlorophenyl)-3-hydroxypropan-2-yl]oxypentan-3-ol (PubChem CID 129084836) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)-3-hydroxypropan-2-yl]oxypentan-3-ol.
| Compound Name | 3-[1-(2-chlorophenyl)-3-hydroxypropan-2-yl]oxypentan-3-ol |
|---|---|
| PubChem CID | 129084836 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-[1-(2-chlorophenyl)-3-hydroxypropan-2-yl]oxypentan-3-ol |
| SMILES | CCC(O)(CC)OC(CO)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClO3/c1-3-14(17,4-2)18-12(10-16)9-11-7-5-6-8-13(11)15/h5-8,12,16-17H,3-4,9-10H2,1-2H3 |
| InChIKey | YMVCMZSJVORPMN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|