About N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine
N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine (PubChem CID 129088197) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine.
Molecular Properties
| Compound Name | N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine |
| PubChem CID | 129088197 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine |
| SMILES | CCCCc1ccc(N=C2N(C)CCN2C)cc1 |
| InChI | InChI=1S/C15H23N3/c1-4-5-6-13-7-9-14(10-8-13)16-15-17(2)11-12-18(15)3/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | GILZMYLBUVAOLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine?
The IUPAC name of N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine (CID 129088197) is N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine.
What is the SMILES notation for N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine?
The canonical SMILES for N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine is CCCCc1ccc(N=C2N(C)CCN2C)cc1.
What is the InChIKey of N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine?
The InChIKey is GILZMYLBUVAOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-4-5-6-13-7-9-14(10-8-13)16-15-17(2)11-12-18(15)3/h7-10H,4-6,11-12H2,1-3H3.
What are the key properties of N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine?
N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine has a molecular weight of 245.37 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butylphenyl)-1,3-dimethylimidazolidin-2-imine is sourced from PubChem (CID 129088197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).