C22H26Cl2N2 — CID 15268673
N,N'-bis(4-butylphenyl)ethanediimidoyl dichloride (PubChem CID 15268673) has the molecular formula C22H26Cl2N2 and a molecular weight of 389.37 g/mol. Its IUPAC name is N,N'-bis(4-butylphenyl)ethanediimidoyl dichloride.
| Compound Name | N,N'-bis(4-butylphenyl)ethanediimidoyl dichloride |
|---|---|
| PubChem CID | 15268673 |
| Molecular Formula | C22H26Cl2N2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N,N'-bis(4-butylphenyl)ethanediimidoyl dichloride |
| SMILES | CCCCc1ccc(/N=C(Cl)/C(Cl)=N/c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C22H26Cl2N2/c1-3-5-7-17-9-13-19(14-10-17)25-21(23)22(24)26-20-15-11-18(12-16-20)8-6-4-2/h9-16H,3-8H2,1-2H3/b25-21-,26-22- |
| InChIKey | JZWYOTZEBDMKKG-ORFRIDJFSA-N |
| XLogP | 7.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|