C20H21FO4 — CID 129089830
[4-[4-(1,2-dihydroxy-2-methylpropyl)-3-fluorophenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 129089830) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is [4-[4-(1,2-dihydroxy-2-methylpropyl)-3-fluorophenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(1,2-dihydroxy-2-methylpropyl)-3-fluorophenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129089830 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [4-[4-(1,2-dihydroxy-2-methylpropyl)-3-fluorophenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(C(O)C(C)(C)O)c(F)c2)cc1 |
| InChI | InChI=1S/C20H21FO4/c1-12(2)19(23)25-15-8-5-13(6-9-15)14-7-10-16(17(21)11-14)18(22)20(3,4)24/h5-11,18,22,24H,1H2,2-4H3 |
| InChIKey | AHZLVJIMXJBFIF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|