C23H41N5O9 — CID 129093136
4-[3-(propan-2-ylamino)oxiran-2-yl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid (PubChem CID 129093136) has the molecular formula C23H41N5O9 and a molecular weight of 531.61 g/mol. Its IUPAC name is 4-[3-(propan-2-ylamino)oxiran-2-yl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid.
| Compound Name | 4-[3-(propan-2-ylamino)oxiran-2-yl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
|---|---|
| PubChem CID | 129093136 |
| Molecular Formula | C23H41N5O9 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 4-[3-(propan-2-ylamino)oxiran-2-yl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
| SMILES | CC(C)NC1OC1CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C23H41N5O9/c1-16(2)24-22-18(37-22)4-3-17(23(35)36)28-11-9-26(14-20(31)32)7-5-25(13-19(29)30)6-8-27(10-12-28)15-21(33)34/h16-18,22,24H,3-15H2,1-2H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | SCHVXFOSEULSPK-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 186.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|