C24H18Cl2FN3O2 — CID 129094964
5-N-benzyl-3-chloro-1-[(4-chloro-3-fluorophenyl)methyl]indole-2,5-dicarboxamide (PubChem CID 129094964) has the molecular formula C24H18Cl2FN3O2 and a molecular weight of 470.33 g/mol. Its IUPAC name is 5-N-benzyl-3-chloro-1-[(4-chloro-3-fluorophenyl)methyl]indole-2,5-dicarboxamide.
| Compound Name | 5-N-benzyl-3-chloro-1-[(4-chloro-3-fluorophenyl)methyl]indole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 129094964 |
| Molecular Formula | C24H18Cl2FN3O2 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 5-N-benzyl-3-chloro-1-[(4-chloro-3-fluorophenyl)methyl]indole-2,5-dicarboxamide |
| SMILES | NC(=O)c1c(Cl)c2cc(C(=O)NCc3ccccc3)ccc2n1Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C24H18Cl2FN3O2/c25-18-8-6-15(10-19(18)27)13-30-20-9-7-16(11-17(20)21(26)22(30)23(28)31)24(32)29-12-14-4-2-1-3-5-14/h1-11H,12-13H2,(H2,28,31)(H,29,32) |
| InChIKey | SUBDHDYEZWMVCR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |