C16H20FN3O2 — CID 129096376
5-(4-fluorophenyl)-2-[(2S,4R)-4-(2-methoxyethoxy)pyrrolidin-2-yl]-1H-imidazole (PubChem CID 129096376) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[(2S,4R)-4-(2-methoxyethoxy)pyrrolidin-2-yl]-1H-imidazole.
| Compound Name | 5-(4-fluorophenyl)-2-[(2S,4R)-4-(2-methoxyethoxy)pyrrolidin-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 129096376 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[(2S,4R)-4-(2-methoxyethoxy)pyrrolidin-2-yl]-1H-imidazole |
| SMILES | COCCO[C@H]1CN[C@H](c2ncc(-c3ccc(F)cc3)[nH]2)C1 |
| InChI | InChI=1S/C16H20FN3O2/c1-21-6-7-22-13-8-14(18-9-13)16-19-10-15(20-16)11-2-4-12(17)5-3-11/h2-5,10,13-14,18H,6-9H2,1H3,(H,19,20)/t13-,14+/m1/s1 |
| InChIKey | SDEOBYDUXHWWHX-KGLIPLIRSA-N |
| XLogP | 2.28 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|