C5H6BrFO3 — CID 129098089
(3S,5S)-3-bromo-3-fluoro-5-(hydroxymethyl)oxolan-2-one (PubChem CID 129098089) has the molecular formula C5H6BrFO3 and a molecular weight of 213.00 g/mol. Its IUPAC name is (3S,5S)-3-bromo-3-fluoro-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (3S,5S)-3-bromo-3-fluoro-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 129098089 |
| Molecular Formula | C5H6BrFO3 |
| Molecular Weight | 213.00 g/mol |
| Exact Mass | 211.95 |
| IUPAC Name | (3S,5S)-3-bromo-3-fluoro-5-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](CO)C[C@]1(F)Br |
| InChI | InChI=1S/C5H6BrFO3/c6-5(7)1-3(2-8)10-4(5)9/h3,8H,1-2H2/t3-,5+/m0/s1 |
| InChIKey | ABDJYEJAJUNMCD-WVZVXSGGSA-N |
| XLogP | 0.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.00 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|