C5H6BrFO4 — CID 170836452
(3S)-3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one (PubChem CID 170836452) has the molecular formula C5H6BrFO4 and a molecular weight of 229.00 g/mol. Its IUPAC name is (3S)-3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (3S)-3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 170836452 |
| Molecular Formula | C5H6BrFO4 |
| Molecular Weight | 229.00 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | (3S)-3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1OC(CO)C(O)[C@]1(F)Br |
| InChI | InChI=1S/C5H6BrFO4/c6-5(7)3(9)2(1-8)11-4(5)10/h2-3,8-9H,1H2/t2?,3?,5-/m1/s1 |
| InChIKey | KKILIAFGHAFQJP-VUYXPMRHSA-N |
| XLogP | -0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.00 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|