C5H7F2O6S- — CID 22848233
(4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonate (PubChem CID 22848233) has the molecular formula C5H7F2O6S- and a molecular weight of 233.17 g/mol. Its IUPAC name is (4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonate.
| Compound Name | (4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonate |
|---|---|
| PubChem CID | 22848233 |
| Molecular Formula | C5H7F2O6S- |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | (4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonate |
| SMILES | O=S(=O)([O-])C1O[C@H](CO)[C@@H](O)C1(F)F |
| InChI | InChI=1S/C5H8F2O6S/c6-5(7)3(9)2(1-8)13-4(5)14(10,11)12/h2-4,8-9H,1H2,(H,10,11,12)/p-1/t2-,3-,4?/m1/s1 |
| InChIKey | KBDKOYYFINOWDM-HERZVMAMSA-M |
| XLogP | -1.75 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|