C16H18N2O3 — CID 129104476
4-amino-2-(1-hydroxycyclohexyl)quinoline-3-carboxylic acid (PubChem CID 129104476) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-amino-2-(1-hydroxycyclohexyl)quinoline-3-carboxylic acid.
| Compound Name | 4-amino-2-(1-hydroxycyclohexyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 129104476 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-amino-2-(1-hydroxycyclohexyl)quinoline-3-carboxylic acid |
| SMILES | Nc1c(C(=O)O)c(C2(O)CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C16H18N2O3/c17-13-10-6-2-3-7-11(10)18-14(12(13)15(19)20)16(21)8-4-1-5-9-16/h2-3,6-7,21H,1,4-5,8-9H2,(H2,17,18)(H,19,20) |
| InChIKey | ZCLIJRCDVCWERY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |