C9H21NO8P2 — CID 129105080
[(8-hydroxyoctanoylamino)-phosphonomethyl]phosphonic acid (PubChem CID 129105080) has the molecular formula C9H21NO8P2 and a molecular weight of 333.21 g/mol. Its IUPAC name is [(8-hydroxyoctanoylamino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(8-hydroxyoctanoylamino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 129105080 |
| Molecular Formula | C9H21NO8P2 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [(8-hydroxyoctanoylamino)-phosphonomethyl]phosphonic acid |
| SMILES | O=C(CCCCCCCO)NC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H21NO8P2/c11-7-5-3-1-2-4-6-8(12)10-9(19(13,14)15)20(16,17)18/h9,11H,1-7H2,(H,10,12)(H2,13,14,15)(H2,16,17,18) |
| InChIKey | JXQCZDNKZUSWIZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|