C21H20N4O6 — CID 129107648
2,5-diamino-4-(3,4-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 129107648) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2,5-diamino-4-(3,4-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-diamino-4-(3,4-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 129107648 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2,5-diamino-4-(3,4-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | COc1cc(C2=C3C(=O)N(N)C(c4ccc(OC)c(OC)c4)=C3C(=O)N2N)ccc1O |
| InChI | InChI=1S/C21H20N4O6/c1-29-13-7-5-11(9-15(13)31-3)19-17-16(20(27)25(19)23)18(24(22)21(17)28)10-4-6-12(26)14(8-10)30-2/h4-9,26H,22-23H2,1-3H3 |
| InChIKey | NMWBVYDVTLJMIM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|