C25H38ClN3O3 — CID 129108497
3-[[[3-[5-chloro-3-[ethyl(oxan-4-yl)amino]-2-methylphenyl]oxiran-2-yl]amino]methyl]-1,4,6-trimethylpiperidin-2-one (PubChem CID 129108497) has the molecular formula C25H38ClN3O3 and a molecular weight of 464.05 g/mol. Its IUPAC name is 3-[[[3-[5-chloro-3-[ethyl(oxan-4-yl)amino]-2-methylphenyl]oxiran-2-yl]amino]methyl]-1,4,6-trimethylpiperidin-2-one.
| Compound Name | 3-[[[3-[5-chloro-3-[ethyl(oxan-4-yl)amino]-2-methylphenyl]oxiran-2-yl]amino]methyl]-1,4,6-trimethylpiperidin-2-one |
|---|---|
| PubChem CID | 129108497 |
| Molecular Formula | C25H38ClN3O3 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 3-[[[3-[5-chloro-3-[ethyl(oxan-4-yl)amino]-2-methylphenyl]oxiran-2-yl]amino]methyl]-1,4,6-trimethylpiperidin-2-one |
| SMILES | CCN(c1cc(Cl)cc(C2OC2NCC2C(=O)N(C)C(C)CC2C)c1C)C1CCOCC1 |
| InChI | InChI=1S/C25H38ClN3O3/c1-6-29(19-7-9-31-10-8-19)22-13-18(26)12-20(17(22)4)23-24(32-23)27-14-21-15(2)11-16(3)28(5)25(21)30/h12-13,15-16,19,21,23-24,27H,6-11,14H2,1-5H3 |
| InChIKey | OYZZFVLQLRBEJO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|