C15H22BNO — CID 144610773
CID 144610773 (PubChem CID 144610773) has the molecular formula C15H22BNO and a molecular weight of 243.16 g/mol.
| Compound Name | CID 144610773 |
|---|---|
| PubChem CID | 144610773 |
| Molecular Formula | C15H22BNO |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C)c(C)c(N(CC)C2CCOCC2)c1 |
| InChI | InChI=1S/C15H22BNO/c1-4-17(14-5-7-18-8-6-14)15-10-13(16)9-11(2)12(15)3/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | URQQFAWQKCKBIL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|