C33H41N3O — CID 129109661
(4R)-2-[4-(1,2,5a,6,7,9a-hexahydrodibenzofuran-2-yl)cyclohex-3-en-1-yl]-6-(cyclohexen-1-yl)-4-cyclohex-2-en-1-yl-1,4-dihydro-1,3,5-triazine (PubChem CID 129109661) has the molecular formula C33H41N3O and a molecular weight of 495.71 g/mol. Its IUPAC name is (4R)-2-[4-(1,2,5a,6,7,9a-hexahydrodibenzofuran-2-yl)cyclohex-3-en-1-yl]-6-(cyclohexen-1-yl)-4-cyclohex-2-en-1-yl-1,4-dihydro-1,3,5-triazine.
| Compound Name | (4R)-2-[4-(1,2,5a,6,7,9a-hexahydrodibenzofuran-2-yl)cyclohex-3-en-1-yl]-6-(cyclohexen-1-yl)-4-cyclohex-2-en-1-yl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 129109661 |
| Molecular Formula | C33H41N3O |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (4R)-2-[4-(1,2,5a,6,7,9a-hexahydrodibenzofuran-2-yl)cyclohex-3-en-1-yl]-6-(cyclohexen-1-yl)-4-cyclohex-2-en-1-yl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CC([C@H]2N=C(C3=CCCCC3)NC(C3CC=C(C4C=CC5=C(C4)C4C=CCCC4O5)CC3)=N2)CCC1 |
| InChI | InChI=1S/C33H41N3O/c1-3-9-23(10-4-1)31-34-32(24-11-5-2-6-12-24)36-33(35-31)25-17-15-22(16-18-25)26-19-20-30-28(21-26)27-13-7-8-14-29(27)37-30/h3,7,9,11,13,15,19-20,23,25-27,29,31H,1-2,4-6,8,10,12,14,16-18,21H2,(H,34,35,36)/t23?,25?,26?,27?,29?,31-/m0/s1 |
| InChIKey | QLFFFUSMKVATSD-LFUMVYETSA-N |
| XLogP | 7.49 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|